A7752112
Propiconazole , Analysis criteria, the heterogeneous mixture , 60207-90-1
CAS NO.:60207-90-1
Empirical Formula: C15H17Cl2N3O2
Molecular Weight: 342.22
MDL number: MFCD00055299
EINECS: 262-104-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <25 °C |
| Boiling point: | 180°C (0.1 torr) |
| Density | 1.2700 |
| vapor pressure | 5.6 x l0-5 Pa (25 °C) |
| refractive index | 1.6100 (estimate) |
| Flash point: | 11 °C |
| storage temp. | APPROX 4°C |
| solubility | DMF: 33 mg/ml,DMF:PBS (pH 7.2)(1:3): 0.16 mg/ml,DMSO: 20 mg/ml,Ethanol: 10 mg/ml |
| form | Oil |
| Water Solubility | 100 mg l-1(2O °C) |
| pka | 2.94±0.12(Predicted) |
| Specific Gravity | 1.29 (20℃) |
| Merck | 13,7910 |
| BRN | 9349305 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C15H17Cl2N3O2/c1-2-3-12-7-21-15(22-12,8-20-10-18-9-19-20)13-5-4-11(16)6-14(13)17/h4-6,9-10,12H,2-3,7-8H2,1H3 |
| InChIKey | STJLVHWMYQXCPB-UHFFFAOYSA-N |
| SMILES | CCCC1COC(Cn2cncn2)(O1)c3ccc(Cl)cc3Cl |
| LogP | 3.7 at 25℃ |
| CAS DataBase Reference | 60207-90-1(CAS DataBase Reference) |
| EPA Substance Registry System | Propiconazole (60207-90-1) |
Description and Uses
Propiconazole is a mixture of four stereoisomers and was first developed in 1979 by Janssen Pharmaceutical of Belgium.
Labelled Propiconazole (P770100). Systemic foliar fungicide. Agricultural fungicide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H317-H360D-H410 |
| Precautionary statements | P202-P273-P280-P301+P312-P302+P352-P308+P313 |
| Hazard Codes | Xn,N,T,F |
| Risk Statements | 22-43-50/53-39/23/24/25-23/24/25-11 |
| Safety Statements | 36/37-46-60-61-45-16-7 |
| RIDADR | UN3082 9/PG 3 |
| WGK Germany | 3 |
| RTECS | XZ4620000 |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Repr. 1B Skin Sens. 1 |
| Hazardous Substances Data | 60207-90-1(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 1517 mg/kg (Urech) |







