A7756412
Tris(4-methoxy-3,5-dimethylphenyl)phosphine , 97% , 121898-64-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB103.20 | In Stock |
|
| 500MG | RMB297.60 | In Stock |
|
| 1G | RMB476.80 | In Stock |
|
| 5g | RMB2319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174-179 °C |
| Boiling point: | 539.3±50.0 °C(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | crystal |
| color | white |
| InChI | 1S/C27H33O3P/c1-16-10-22(11-17(2)25(16)28-7)31(23-12-18(3)26(29-8)19(4)13-23)24-14-20(5)27(30-9)21(6)15-24/h10-15H,1-9H3 |
| InChIKey | BDGUINGZRGNLPD-UHFFFAOYSA-N |
| SMILES | COc1c(C)cc(cc1C)P(c2cc(C)c(OC)c(C)c2)c3cc(C)c(OC)c(C)c3 |
Description and Uses
Catalyst for carbocyanation of alkynes
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H413 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| TSCA | No |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
