A7757712
2,4,5-Trimethoxybenzoic acid , 99% , 490-64-2
Synonym(s):
Asaronic acid
CAS NO.：490-64-2
Empirical Formula: C10H12O5
Molecular Weight: 212.2
MDL number: MFCD00002435
EINECS: 207-715-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 10G | RMB52.00 | In Stock |
|
| 25G | RMB79.20 | In Stock |
|
| 50G | RMB245.60 | In Stock |
|
| 100G | RMB281.60 | In Stock |
|
| 500g | RMB1005.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-145 °C (lit.) |
| Boiling point: | 300 °C |
| Density | 1.3006 (rough estimate) |
| refractive index | 1.5140 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly) |
| pka | 4.24±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | SOLUBLE |
| λmax | 226nm(EtOH)(lit.) |
| InChI | InChI=1S/C10H12O5/c1-13-7-5-9(15-3)8(14-2)4-6(7)10(11)12/h4-5H,1-3H3,(H,11,12) |
| InChIKey | KVZUCOGWKYOPID-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(OC)=C(OC)C=C1OC |
| CAS DataBase Reference | 490-64-2(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2,4,5-trimethoxy- (490-64-2) |
Description and Uses
2,4,5-Trimethoxybenzoic Acid can be used to alleviate, treat, and prevent inflammatory diseases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29189900 |
