PRODUCT Properties
| Melting point: | 235°C |
| Boiling point: | 478.66°C (rough estimate) |
| Density | 1.2764 (rough estimate) |
| refractive index | 1.5855 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO:84.5(Max Conc. mg/mL);246.08(Max Conc. mM) Water:69.0(Max Conc. mg/mL);104.84(Max Conc. mM) |
| form | Solid |
| color | Pale Yellow to Light Yellow |
| InChI | InChI=1S/C15H15N3O.C3H6O3/c1-2-19-10-4-6-13-12(8-10)15(17)11-5-3-9(16)7-14(11)18-13;1-2(4)3(5)6/h3-8H,2,16H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6) |
| InChIKey | IYLLULUTZPKQBW-UHFFFAOYSA-N |
| SMILES | C12C=C(C=CC1=NC1=CC(N)=CC=C1C=2N)OCC.C(O)(C)C(=O)O |
| CAS DataBase Reference | 1837-57-6(CAS DataBase Reference) |
| EPA Substance Registry System | Rivanol (1837-57-6) |
Description and Uses
2-Ethoxy-6,9-diaminoacridine Lactate is used in treating purulent-necrotic wounds of hooves in cattle.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| TSCA | TSCA listed |





