N-Boc-L-Tert-Leucine , 98% , 62965-35-9
Synonym(s):
(S)-N-Boc-2-amino-3,3-dimethylbutyric acid;Boc-L -tert-leucine;Boc-L-α-t-butylglycine;N-α-t.-Boc-L-α-t.-butyl-glycine,N-α-t.-Boc-L-t-leucine
CAS NO.:62965-35-9
Empirical Formula: C11H21NO4
Molecular Weight: 231.29
MDL number: MFCD00065574
EINECS: 613-118-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB33.60 | In Stock |
|
| 25G | RMB63.20 | In Stock |
|
| 100G | RMB199.20 | In Stock |
|
| 500g | RMB719.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 118-121 °C |
| alpha | -4.2 º (c=1% in glacial acetic acid) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| color | White to slightly yellow |
| optical activity | [α]20/D 4.2±0.5°, c = 1% in glacial acetic acid |
| BRN | 1962763 |
| InChI | InChI=1/C11H21NO4/c1-10(2,3)7(8(13)14)12-9(15)16-11(4,5)6/h7H,1-6H3,(H,12,15)(H,13,14)/t7-/s3 |
| InChIKey | LRFZIPCTFBPFLX-SSDOTTSWSA-N |
| SMILES | [C@@H](C(=O)O)(C(C)(C)C)NC(=O)OC(C)(C)C |&1:0,r| |
| CAS DataBase Reference | 62965-35-9(CAS DataBase Reference) |
Description and Uses
N-Boc-L-tert-Leucine is a white to slightly yellow crystalline powder. The carboxyl group in its structure can be condensed with alcohol compounds under the catalysis of acid or base to obtain the corresponding ester derivatives. This substance can be used for the synthesis of amino acid drugs due to the various chemical transformation properties of its amine and carboxyl groups. The Boc protective group is able to protect the amino group of the amino acid from non-specific reactions with other reactants. This compound is a derivative of L-tert-Leucine, which is a non-polar amino acid. Its tert-butyl group exhibits significant hydrophobicity and steric hindrance, enabling effective control of molecular conformation in chemical reactions, leading to the formation of chiral compounds. As a crucial chiral intermediate, L-tert-leucine is widely employed in the synthesis of anti-cancer, anti-viral, and biological inhibitors. Additionally, L-tert-leucine serves as an essential additive in the food and cosmetic industry.
Atazanavir Related Compound A
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H290 |
| Precautionary statements | P501-P260-P234-P264-P280-P390-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P406-P405 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 2924 19 00 |
| HazardClass | IRRITANT |







