A1272512
BOC-L-Prolinol , 98% , 69610-40-8
Synonym(s):
(S)-1-Boc-2-pyrrolidinemethanol
CAS NO.:69610-40-8
Empirical Formula: C10H19NO3
Molecular Weight: 201.26
MDL number: MFCD00066232
EINECS: 627-775-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB20.00 | In Stock |
|
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB71.20 | In Stock |
|
| 100G | RMB252.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-64 °C (lit.) |
| Boiling point: | 150 °C / 4mmHg |
| alpha | -52 º (c=1, CHCl3) |
| Density | 1.0948 (rough estimate) |
| refractive index | -55 ° (C=5, MeOH) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly), Water (Slightly) |
| pka | 14.77±0.10(Predicted) |
| form | Crystalline Powder |
| color | White |
| optical activity | [α]21/D 48°, c = 1.3 in chloroform |
| Water Solubility | insoluble |
| BRN | 3542667 |
| Major Application | peptide synthesis |
| InChI | 1S/C10H19NO3/c1-10(2,3)14-9(13)11-6-4-5-8(11)7-12/h8,12H,4-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | BFFLLBPMZCIGRM-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1CO |
| CAS DataBase Reference | 69610-40-8(CAS DataBase Reference) |
Description and Uses
Building block for novel nicotinic acetylcholine receptor ligands with cognition-enhancing properties. Used in the synthesis of chiral β-amino sulfides and β-amino thiols.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |







