A7765012
Triethoxyphenylsilane , 98% , 780-69-8
Synonym(s):
Phenyltriethoxysilane
CAS NO.:780-69-8
Empirical Formula: C12H20O3Si
Molecular Weight: 240.37
MDL number: MFCD00009065
EINECS: 212-305-8
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB32.80 | In Stock |
|
| 100ML | RMB79.20 | In Stock |
|
| 500ML | RMB261.60 | In Stock |
|
| 1L | RMB426.40 | In Stock |
|
| 5l | RMB1692.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-50°C |
| Boiling point: | 112-113 °C10 mm Hg(lit.) |
| Density | 0.996 g/mL at 25 °C(lit.) |
| vapor density | >1 (vs air) |
| vapor pressure | 0-7910Pa at 20-25℃ |
| refractive index | n |
| Flash point: | 109 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | liquid |
| Specific Gravity | 0.996 |
| color | Colorless to Almost colorless |
| Odor | Mild odor |
| Water Solubility | insoluble |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 2940602 |
| InChI | 1S/C12H20O3Si/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12/h7-11H,4-6H2,1-3H3 |
| InChIKey | JCVQKRGIASEUKR-UHFFFAOYSA-N |
| SMILES | CCO[Si](OCC)(OCC)c1ccccc1 |
| LogP | -0.31-3.4 at 22℃ |
| CAS DataBase Reference | 780-69-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Triethoxyphenylsilane(780-69-8) |
| EPA Substance Registry System | Silane, triethoxyphenyl- (780-69-8) |
Description and Uses
Phenyltriethoxysilane, a silane coupling agent, is used in preparation of self-healing or reusable coatings.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H373-H412 |
| Precautionary statements | P260-P273-P314-P501 |
| target organs | Urinary bladder |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 10-21-36/37/38 |
| Safety Statements | 37/39-26-16-24/25 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| RTECS | VV4900000 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29310095 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Chronic 3 Flam. Liq. 3 STOT RE 2 Oral |






