A7768312
5,6,7,8-Tetrahydronaphthalene-1-carboxylic Acid , 98% , 4242-18-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB69.60 | In Stock |
|
| 5G | RMB198.40 | In Stock |
|
| 25G | RMB799.20 | In Stock |
|
| 100g | RMB2879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150.0 to 154.0 °C |
| Boiling point: | 336.8±31.0 °C(Predicted) |
| Density | 1.184±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.26±0.20(Predicted) |
| color | White |
| InChI | InChI=1S/C11H12O2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h3,5,7H,1-2,4,6H2,(H,12,13) |
| InChIKey | GCFQXKYHWFWGSB-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=C2C(CCCC2)=CC=C1 |
| CAS DataBase Reference | 4242-18-6(CAS DataBase Reference) |
Description and Uses
5,6,7,8-Tetrahydronaphthalene-1-carboxylic acid is an intermediate used for the preparation of the therapeutically useful antiemetic agent Palonosetron (P165805).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| WGK Germany | WGK 3 |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |




![(S)-N-(1-Azabicyclo[2.2.2]oct-3-yl)-5,6,7,8-tetrahydro-1-naphthalenecarboxamide](https://img.chemicalbook.com/CAS/GIF/135729-78-1.gif)


