A7770312
4-Thiazolecarboxylic acid , 97% , 3973-08-8
CAS NO.：3973-08-8
Empirical Formula: C4H3NO2S
Molecular Weight: 129.14
MDL number: MFCD00623589
EINECS: 628-056-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB40.00 | In Stock |
|
| 5G | RMB80.00 | In Stock |
|
| 25g | RMB273.60 | In Stock |
|
| 100g | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195-199 °C (lit.) |
| Boiling point: | 191 °C |
| Density | 1.525±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.57±0.10(Predicted) |
| color | White to Off-White |
| λmax | 230nm(EtOH)(lit.) |
| InChI | InChI=1S/C4H3NO2S/c6-4(7)3-1-8-2-5-3/h1-2H,(H,6,7) |
| InChIKey | HMVYYTRDXNKRBQ-UHFFFAOYSA-N |
| SMILES | S1C=C(C(O)=O)N=C1 |
| CAS DataBase Reference | 3973-08-8(CAS DataBase Reference) |
Description and Uses
4-Thiazolecarboxylic Acid (cas# 3973-08-8) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29341000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
