A7774712
Thiophene-2-boronic acid pinacol ester , 98% , 193978-23-3
Synonym(s):
4,4,5,5-Tetramethyl-2-(2-thienyl)-1,3,2-dioxaborolane;4,4,5,5-Tetramethyl-2-(thiophen-2-yl)-1,3,2-dioxaborolane
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB60.00 | In Stock |
|
| 25G | RMB256.80 | In Stock |
|
| 100g | RMB929.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68-70°C |
| Boiling point: | 286.5±13.0 °C(Predicted) |
| Density | 1.07±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | soluble in Methanol |
| form | Solid |
| color | White to Almost white |
| λmax | 239 nm at 0.01 g/L in methanol |
| InChI | InChI=1S/C10H15BO2S/c1-9(2)10(3,4)13-11(12-9)8-6-5-7-14-8/h5-7H,1-4H3 |
| InChIKey | FFZHICFAHSDFKZ-UHFFFAOYSA-N |
| SMILES | O1C(C)(C)C(C)(C)OB1C1SC=CC=1 |
| CAS DataBase Reference | 193978-23-3(CAS DataBase Reference) |
Description and Uses
Thiophene-2-boronic Acid Pinacol Ester acts as a reagent in the synthesis of bis-amide derivatives as CSF1R inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 |
| Hazard Codes | T |
| Risk Statements | 36/37/38-25 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Storage Class | 13 - Non Combustible Solids |
