A7775912
2-(Trifluoromethyl)benzamide , 98% , 360-64-5
CAS NO.：360-64-5
Empirical Formula: C8H6F3NO
Molecular Weight: 189.13
MDL number: MFCD00014798
EINECS: 206-637-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB34.40 | In Stock |
|
| 5G | RMB84.24 | In Stock |
|
| 10g | RMB115.20 | In Stock |
|
| 25G | RMB216.72 | In Stock |
|
| 100g | RMB723.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-164 °C (lit.) |
| Boiling point: | 247.3±40.0 °C(Predicted) |
| Density | 1.335±0.06 g/cm3(Predicted) |
| vapor pressure | 3.466Pa at 25℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 15.46±0.50(Predicted) |
| color | White to Almost white |
| Water Solubility | 13g/L |
| BRN | 2616148 |
| InChI | InChI=1S/C8H6F3NO/c9-8(10,11)6-4-2-1-3-5(6)7(12)13/h1-4H,(H2,12,13) |
| InChIKey | QBAYIBZITZBSFO-UHFFFAOYSA-N |
| SMILES | C(N)(=O)C1=CC=CC=C1C(F)(F)F |
| LogP | 0.68 |
| CAS DataBase Reference | 360-64-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzamide, 2-(trifluoromethyl)- (360-64-5) |
Description and Uses
2-(Trifluoromethyl)benzamide-D4 is an isotopic labeled intermediate for organic synthesis processes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2924297099 |
