PRODUCT Properties
| Melting point: | 234-236 °C (lit.) |
| Boiling point: | 320.83°C (rough estimate) |
| Density | 1.2653 (rough estimate) |
| refractive index | 1.5740 (estimate) |
| pka | 8.98±0.40(Predicted) |
| form | powder to crystal |
| color | Light yellow to Yellow to Green |
| BRN | 15827 |
| InChI | 1S/C15H10O3/c16-11-6-7-14-12(8-11)13(17)9-15(18-14)10-4-2-1-3-5-10/h1-9,16H |
| InChIKey | GPZYYYGYCRFPBU-UHFFFAOYSA-N |
| SMILES | Oc1ccc2OC(=CC(=O)c2c1)c3ccccc3 |
| LogP | 4.445 (est) |
| CAS DataBase Reference | 6665-83-4(CAS DataBase Reference) |
Description and Uses
anxiolytic
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2932.99.7000 |
| Storage Class | 11 - Combustible Solids |





