A7777558
1-Methylpyridinium-2-aldoximeChloride , 10mMinWater , 51-15-0
Synonym(s):
2-PAM chloride;Pralidoxime chloride;Pyridine-2-aldoxime methochloride
CAS NO.:51-15-0
Empirical Formula: C7H9ClN2O
Molecular Weight: 172.61
MDL number: MFCD00011981
EINECS: 200-080-9
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230 °C (lit.) |
| Density | 1.3265 (rough estimate) |
| refractive index | 1.5430 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Methanol (Slightly), Water (Sparingly) |
| pka | pKa 7.8-8 (Uncertain) |
| form | Solid |
| color | White to Off-White |
| biological source | synthetic (organic) |
| Water Solubility | 65.5 g/100 mL (25 ºC) |
| Merck | 14,7703 |
| BRN | 4163981 |
| InChI | InChI=1S/C7H8N2O.ClH/c1-9-5-3-2-4-7(9)6-8-10;/h2-6H,1H3;1H |
| InChIKey | HIGSLXSBYYMVKI-UHFFFAOYSA-N |
| SMILES | C1(/C=N/O)C=CC=C[N+]=1C.[Cl-] |
| CAS DataBase Reference | 51-15-0(CAS DataBase Reference) |
| EPA Substance Registry System | Pralidoxime chloride (51-15-0) |
Description and Uses
vitamin B6, enzyme cofactor
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P280-P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-20/22 |
| Safety Statements | 36-37/39-26 |
| WGK Germany | 3 |
| RTECS | UU4200000 |
| HS Code | 29333999 |
| Toxicity | LD50 in rats (mg/kg): 96 i.v. (Fleisher); LD50 in rabbits (mg/kg): 95 i.v.; LD50 in mice (mg/kg): 115 i.v., 205 i.p., 4100 orally (Ellin, Wills) |






