PRODUCT Properties
| Melting point: | 178 °C(lit.) |
| alpha | D20 -60° (c = 1.4) |
| Boiling point: | 386.76°C (rough estimate) |
| Density | 1.3514 (rough estimate) |
| refractive index | -62 ° (C=0.8, H2O) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Methanol, Water |
| pka | 12.77±0.70(Predicted) |
| form | Crystalline Powder |
| color | White to yellow |
| optical activity | [α]25/D 57.1°, c = 1.5 in H2O |
| Water Solubility | 16.39g/L(cold water) |
| Merck | 14,4628 |
| BRN | 89596 |
| InChI | 1S/C13H16O7/c14-5-7-3-1-2-4-8(7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-5,9-13,15-18H,6H2/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | BGOFCVIGEYGEOF-UJPOAAIJSA-N |
| SMILES | [H]C(=O)c1ccccc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O |
| LogP | -1.440 (est) |
| CAS DataBase Reference | 618-65-5(CAS DataBase Reference) |
Description and Uses
Helicin (cas# 618-65-5) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
