BD8117631
Phloridzin , 98% , 60-81-1
Synonym(s):
Phlorizin;Phlorizin dihydrate;1-[2-(β-D -Glucopyranosyloxy)-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)-1-propanone;Floridzin;Phloretin 2′-β-D -glucopyranoside
CAS NO.：60-81-1
Empirical Formula: C21H24O10
Molecular Weight: 436.41
MDL number: MFCD00006591
EINECS: 200-487-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.80 | In Stock |
|
| 5g | RMB139.20 | In Stock |
|
| 10g | RMB250.40 | In Stock |
|
| 25g | RMB503.20 | In Stock |
|
| 100g | RMB1587.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-114 °C(lit.) |
| Boiling point: | 468.89°C (rough estimate) |
| Density | 1.3178 (rough estimate) |
| refractive index | -54 ° (C=3.2, 95% EtOH) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 7.15±0.40(Predicted) |
| color | Light Yellow to Tan |
| Merck | 14,7327 |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChIKey | IOUVKUPGCMBWBT-LKLLPNDVNA-N |
| SMILES | C(C1C(=CC(O)=CC=1O[C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)O)(=O)CCC1C=CC(O)=CC=1 |&1:9,10,11,13,15,r| |
| LogP | 0.452 (est) |
| CAS DataBase Reference | 60-81-1(CAS DataBase Reference) |
| EPA Substance Registry System | Phlorizin (60-81-1) |
Description and Uses
induces experimental glucosuria, antifeedant
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | UC2080000 |
| F | 3-10-23 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
