A6797012
Phloretin , ≥98% , 60-82-2
Synonym(s):
β-(4-Hydroxyphenyl)-2,4,6-trihydroxypropiophenone;2?,4?,6?-Trihydroxy-3- p-hydroxyphenylpropiophenone;2?,4?,6?-Trihydroxy-3-p-hydroxyphenylpropiophenone;2′,4′,6′-Trihydroxy-3-(4-hydroxyphenyl)propiophenone;3-(4-Hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-1-propanone
CAS NO.:60-82-2
Empirical Formula: C15H14O5
Molecular Weight: 274.27
MDL number: MFCD00002288
EINECS: 200-488-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB38.40 | In Stock |
|
| 5G | RMB92.00 | In Stock |
|
| 25g | RMB233.60 | In Stock |
|
| 100g | RMB653.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~260 °C |
| Boiling point: | 337.26°C (rough estimate) |
| Density | 1.1827 (rough estimate) |
| FEMA | 4390 | 3-(4-HYDROXYPHENYL)-1-(2,4,6-TRIHYDROXYPHENYL)PROPAN-1-ONE |
| refractive index | 1.573-1.575 |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Methanol (Slightly) |
| pka | 7.16±0.40(Predicted) |
| form | Powder |
| color | White to beige |
| Odor | odorless |
| Water Solubility | soluble |
| Merck | 14,7326 |
| JECFA Number | 2022 |
| BRN | 1887240 |
| Cosmetics Ingredients Functions | ANTI-SEBUM ANTIOXIDANT |
| InChI | 1S/C15H14O5/c16-10-4-1-9(2-5-10)3-6-12(18)15-13(19)7-11(17)8-14(15)20/h1-2,4-5,7-8,16-17,19-20H,3,6H2 |
| InChIKey | VGEREEWJJVICBM-UHFFFAOYSA-N |
| SMILES | Oc1ccc(CCC(=O)c2c(O)cc(O)cc2O)cc1 |
| LogP | 3.50 |
| CAS DataBase Reference | 60-82-2(CAS DataBase Reference) |
Description and Uses
Phloretin has been used:
- to study its effect on the 2-[N-(7-Nitrobenz-2-oxa-1,3-diazol-4-yl)amino]-2-deoxy-d-glucose (2-NBDG) and 2-[N-(7-Nitrobenz-2-oxa-1,3-diazol-4-yl)amino]-2-deoxy-l-glucose (2-NBDLG) uptake
- to incubate microvesicles in order to inhibit GLUT1 (glucose transporter 1)-mediated transport in radioactive ligand up-take assay
- as a component of KRH buffer to stop glucose uptake by trophoblast cells in vitro
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 3 |
| F | 3-10 |
| HazardClass | IRRITANT |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





