A4924612
1-(3-Hydroxyphenyl)propan-1-one , 97% , 13103-80-5
CAS NO.：13103-80-5
Empirical Formula: C9H10O2
Molecular Weight: 150.17
MDL number: MFCD03428514
EINECS: 236-027-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 250MG | RMB29.60 | In Stock |
|
| 5g | RMB80.00 | In Stock |
|
| 25g | RMB367.20 | In Stock |
|
| 100g | RMB1412.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82 °C |
| Boiling point: | 288.9±23.0 °C(Predicted) |
| Density | 1.104±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.09±0.10(Predicted) |
| color | Off-White to Beige |
| InChI | InChI=1S/C9H10O2/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6,10H,2H2,1H3 |
| InChIKey | YXOGDBMOFMQLEU-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC(O)=C1)(=O)CC |
| CAS DataBase Reference | 13103-80-5(CAS DataBase Reference) |
Description and Uses
1-?(3-?Hydroxyphenyl)?-?1-?propanone is a reactant used to synthesize tricyclic fused pyridines, a family of alkaloids with antimalarial activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2914500090 |
