A7781912
                    trans,trans-1,4-Diphenyl-1,3-butadiene , 98% , 538-81-8
                            Synonym(s):
β,β′-Bistyryl;DPB
                            
                        
                CAS NO.:538-81-8
Empirical Formula: C16H14
Molecular Weight: 206.28
MDL number: MFCD00004791
EINECS: 629-554-7
| Pack Size | Price | Stock | Quantity | 
| 5G | RMB87.20 | In Stock | 
                                                 | 
                                        
| 25G | RMB351.20 | In Stock | 
                                                 | 
                                        
| 100G | RMB1271.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 150-152 °C(lit.) | 
                                    
| Boiling point: | 350 °C(lit.) | 
                                    
| Density | 1.151 g/cm3 | 
                                    
| refractive index | 1.5000 (estimate) | 
                                    
| Flash point: | 350°C/720mm | 
                                    
| storage temp. | Sealed in dry,Room Temperature | 
                                    
| form | Crystals or Crystalline Powder | 
                                    
| color | White to slightly yellow | 
                                    
| Water Solubility | Slightly soluble in water. | 
                                    
| Merck | 14,3320 | 
                                    
| BRN | 1905937 | 
                                    
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | 
                                    
| InChI | InChI=1S/C16H14/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-14H/b13-7+,14-8+ | 
                                    
| InChIKey | JFLKFZNIIQFQBS-FNCQTZNRSA-N | 
                                    
| SMILES | C(/C1=CC=CC=C1)=C\C=C\C1=CC=CC=C1 | 
                                    
| CAS DataBase Reference | 538-81-8(CAS DataBase Reference) | 
                                    
Description and Uses
trans,trans-1,4-Diphenyl-1,3-butadiene reacts with Rieke metal complexes of barium and strontium to prepare metal-diene reagents, which is used for the carbocyclization with dichloroalkanes.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-36 | 
| WGK Germany | 3 | 
| F | 10-23 | 
| TSCA | Yes | 
| HS Code | 29029000 | 



![4,6-Diphenylthieno[3,4-d]-1,3-dioxol-2-one 5,5-Dioxide](https://img.chemicalbook.com/CAS/GIF/54714-11-3.gif)


