A7782012
4,4,4-Trifluoro-1-(2-naphthyl)-1,3-butanedione , 99% , 893-33-4
Synonym(s):
1-(2-Naphthoyl)-3,3,3-trifluoroacetone;2-(4,4,4-Trifluoroacetoacetyl)naphthalene;4,4,4-Trifluoro-3-oxo-2′-butyronaphthone
| Pack Size | Price | Stock | Quantity |
| 5G | RMB78.40 | In Stock |
|
| 10g | RMB132.80 | In Stock |
|
| 25G | RMB227.20 | In Stock |
|
| 100G | RMB692.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-72 °C(lit.) |
| Boiling point: | 350.7±37.0 °C(Predicted) |
| Density | 1.3216 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMF: soluble |
| pka | 7.70±0.50(Predicted) |
| form | powder to crystal |
| color | White to Yellow to Orange |
| BRN | 1981085 |
| InChI | InChI=1S/C14H9F3O2/c15-14(16,17)13(19)8-12(18)11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2 |
| InChIKey | WVVLURYIQCXPIV-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C2C(=C1)C=CC=C2)(=O)CC(=O)C(F)(F)F |
| CAS DataBase Reference | 893-33-4(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Butanedione, 4,4,4-trifluoro-1-(2-naphthalenyl)- (893-33-4) |
Description and Uses
4,4,4-Trifluoro-3-oxo-2''-butyronaphthone is a useful fluorescent compound.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 8-10-23 |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29143990 |
