A7787512
                    1,2,3-Tri-O-acetyl-5-deoxy-β-D-ribofuranose , 97% , 62211-93-2
CAS NO.:62211-93-2
Empirical Formula: C11H16O7
Molecular Weight: 260.24
MDL number: MFCD08458459
EINECS: 612-957-7
| Pack Size | Price | Stock | Quantity | 
| 1g | RMB24.00 | In Stock | 
                                                 | 
                                        
| 5G | RMB28.80 | In Stock | 
                                                 | 
                                        
| 25G | RMB47.20 | In Stock | 
                                                 | 
                                        
| 100G | RMB159.20 | In Stock | 
                                                 | 
                                        
| 500g | RMB585.60 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 63-64°C | 
                                    
| Boiling point: | 315°C | 
                                    
| alpha | -19.0 to -23.0 deg(C=2, EtOH) | 
                                    
| Density | 1.23 | 
                                    
| vapor pressure | 0.005-0.01Pa at 20-25℃ | 
                                    
| Flash point: | 136°C | 
                                    
| storage temp. | Sealed in dry,2-8°C | 
                                    
| solubility | Soluble in ethanol | 
                                    
| form | Powder | 
                                    
| color | Yellow to Brown | 
                                    
| optical activity | Consistent with structure | 
                                    
| InChI | InChI=1/C11H16O7/c1-5-9(16-6(2)12)10(17-7(3)13)11(15-5)18-8(4)14/h5,9-11H,1-4H3/t5-,9-,10-,11+/s3 | 
                                    
| InChIKey | NXEJETQVUQAKTO-QPGVQJSANA-N | 
                                    
| SMILES | O([C@H]1[C@@H](O[C@H](C)[C@H]1OC(=O)C)OC(=O)C)C(=O)C |&1:1,2,4,6,r| | 
                                    
| LogP | 0.377-0.43 at 25℃ | 
                                    
| Surface tension | 39.28mN/m at 1.01g/L and 20℃ | 
                                    
| CAS DataBase Reference | 62211-93-2(CAS DataBase Reference) | 
                                    
Description and Uses
Intermediate in the preparation of Cepecitabine.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P305+P351+P338 | 
| Safety Statements | 24/25 | 
| HS Code | 29400090 | 






