A7788712
5-(Trifluoromethyl)pyridine-2-carboxylic acid , ≥98%(GC) , 80194-69-0
Synonym(s):
5-(Trifluoromethyl)picolinic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB48.80 | In Stock |
|
| 5G | RMB150.40 | In Stock |
|
| 25G | RMB569.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135-137°C |
| Boiling point: | 273.7±40.0 °C(Predicted) |
| Density | 1.484±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 3.13±0.10(Predicted) |
| color | Pale brown |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C7H4F3NO2/c8-7(9,10)4-1-2-5(6(12)13)11-3-4/h1-3H,(H,12,13) |
| InChIKey | NJHGVAYLDHROPT-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC=C(C(F)(F)F)C=C1 |
| CAS DataBase Reference | 80194-69-0(CAS DataBase Reference) |
Description and Uses
5-(Trifluoromethyl)pyridine-2-carboxylic acid is an intermediate used in the synthesis of β-secretase (BACE) inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



