A7788812
tert-Butyl 2,2,2-trichloroacetimidate , 97% , 98946-18-0
Synonym(s):
TBTA
CAS NO.:98946-18-0
Empirical Formula: C6H10Cl3NO
Molecular Weight: 218.51
MDL number: MFCD00237376
EINECS: 629-631-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB26.40 | In Stock |
|
| 5G | RMB42.40 | In Stock |
|
| 25G | RMB148.00 | In Stock |
|
| 100G | RMB543.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 21 °C(lit.) |
| Boiling point: | 65 °C11 mm Hg(lit.) |
| Density | 1.222 |
| refractive index | n |
| Flash point: | 131 °F |
| storage temp. | 2-8°C |
| solubility | Soluble in organic solvents, cyclo hexane. |
| form | Liquid or Low Melting Crystalline Mass |
| pka | 2.49±0.70(Predicted) |
| Specific Gravity | 1.222 |
| color | Clear colorless to pale yellow |
| Sensitive | Moisture Sensitive |
| BRN | 1770049 |
| Stability: | Hygroscopic |
| InChI | 1S/C6H10Cl3NO/c1-5(2,3)11-4(10)6(7,8)9/h10H,1-3H3 |
| InChIKey | CQXDYHPBXDZWBA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=N)C(Cl)(Cl)Cl |
| CAS DataBase Reference | 98946-18-0(CAS DataBase Reference) |
Description and Uses
tert-Butyl 2,2,2-trichloroacetimidate is used to produce di-tert-butyl peroxide at temperature of -5°C. It may be used in the synthesis of N-α-Fmoc-phospho(1-nitrophenylethyl-2-cyanoethyl)-L-serine, caged building block. It may be used in the conversion of alcohols and carboxylic acids to their respective ethers and esters.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H302-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P301+P312-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 10-22-36/37/38 |
| Safety Statements | 26-37/39-16-36/37-24/25 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Irritant/Moisture Sensitive |
| TSCA | No |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29252900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




