A7789812
Trifluoromethylthio)aniline , 98% , 372-16-7
CAS NO.：372-16-7
Empirical Formula: C7H6F3NS
Molecular Weight: 193.19
MDL number: MFCD00040926
EINECS: 206-744-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB58.32 | In Stock |
|
| 5G | RMB146.40 | In Stock |
|
| 25G | RMB526.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 102-103 °C/8 mmHg (lit.) |
| Density | 1.351 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 224 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Liquid |
| pka | 2.79±0.10(Predicted) |
| color | Clear colorless to yellow |
| Specific Gravity | 1.351 |
| Water Solubility | insoluble |
| BRN | 2208859 |
| InChI | InChI=1S/C7H6F3NS/c8-7(9,10)12-6-3-1-5(11)2-4-6/h1-4H,11H2 |
| InChIKey | OHHHTUXVBNGOGI-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(SC(F)(F)F)C=C1 |
| CAS DataBase Reference | 372-16-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 4-[(trifluoromethyl)thio]-(372-16-7) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22 |
| Safety Statements | 36-36/37 |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29309090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
