PRODUCT Properties
| Melting point: | >299.85°C |
| Boiling point: | 258.15°C (rough estimate) |
| Density | 1.3818 (rough estimate) |
| refractive index | 1.6190 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO (Sparingly), Methanol (Slightly, Heated, Sonicated) |
| form | Solid |
| pka | 8.61±0.10(Predicted) |
| color | Pale Yellow to Beige |
| Major Application | cell analysis clinical research general analytical life science and biopharma metabolomics |
| InChI | InChI=1S/C5H7N3O2/c6-4-3(2-9)1-7-5(10)8-4/h1,9H,2H2,(H3,6,7,8,10) |
| InChIKey | RYVNIFSIEDRLSJ-UHFFFAOYSA-N |
| SMILES | OCC1=CNC(N=C1N)=O |
Description and Uses
5-(Hydroxymethyl)cytosine is a DNA pyrimidine nitrogen base.It may regulate gene expression or prompt DNA demethylation. 5-Hydroxymethylcytosine may be especially important in the central nervous system, as it is found in very high levels there.
