A7790912
4-(Trifluoromethyl)benzhydrazide , 98% , 339-59-3
Synonym(s):
α,α,α-Trifluoro-p-toluic acid hydrazide
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB142.40 | In Stock |
|
| 25g | RMB639.20 | In Stock |
|
| 100g | RMB1983.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-119 °C(lit.) |
| Density | 1.356±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 11.90±0.10(Predicted) |
| color | Off-White |
| BRN | 1968848 |
| InChI | 1S/C8H7F3N2O/c9-8(10,11)6-3-1-5(2-4-6)7(14)13-12/h1-4H,12H2,(H,13,14) |
| InChIKey | GKBDXTNCBPZMFX-UHFFFAOYSA-N |
| SMILES | NNC(=O)c1ccc(cc1)C(F)(F)F |
| CAS DataBase Reference | 339-59-3(CAS DataBase Reference) |
Description and Uses
4-(Trifluoromethyl)benzhydrazide is a reagent used in the synthesis of benzoyl hydrazone derivatives displaying fungicidal activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2928009090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![N'-[(E)-(3-PHENYL-1H-PYRAZOL-4-YL)METHYLIDENE]-4-(TRIFLUOROMETHYL)BENZENECARBOHYDRAZIDE](https://img.chemicalbook.com/StructureFile/ChemBookStructure4/GIF/CB2125352.gif)


