A7791512
2,4,5-Trifluorobenzyl chloride , 98% , 243139-71-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB179.20 | In Stock |
|
| 5G | RMB647.20 | In Stock |
|
| 25g | RMB2083.20 | In Stock |
|
| 100g | RMB5599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 175℃ |
| Density | 1,689 g/cm3 |
| refractive index | 1.5050 |
| Flash point: | 65°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C7H4ClF3/c8-3-4-1-6(10)7(11)2-5(4)9/h1-2H,3H2 |
| InChIKey | JMXPOOVDUVHJRO-UHFFFAOYSA-N |
| SMILES | C1(CCl)=CC(F)=C(F)C=C1F |
| CAS DataBase Reference | 243139-71-1(CAS DataBase Reference) |
Description and Uses
2,4,5-Trifluorobenzyl chloride is an oral dipeptidyl peptidase-4 (DPP-4) inhibitor that decreases in glucagon to improve control of blood sugar used for the treatment of type 1 diabetes, 79% of the dose excreted in the urine.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H227-H290-H314-H318 |
| Precautionary statements | P210e-P260h-P303+P361+P353-P305+P351+P338-P501a-P210-P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P403+P235-P405-P406-P501 |
| Hazard Codes | C,Xn |
| Risk Statements | 34-36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | 3265 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2903998090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





![Benzenebutanoicacid,b-[[(1,1-diMethylethoxy)carbonyl]aMino]-2,4,5-trifluoro-,Methylester,(bR)-](https://img.chemicalbook.com/CAS/20150408/GIF/881995-73-9.gif)

