A6093712
Methyl 3-oxo-4-(2,4,5-trifluorophenyl)butanoate , 97% , 769195-26-8
CAS NO.：769195-26-8
Empirical Formula: C11H9F3O3
Molecular Weight: 246.19
MDL number: MFCD09833197
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB48.00 | In Stock |
|
| 1G | RMB130.40 | In Stock |
|
| 5g | RMB407.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-41 °C |
| Boiling point: | 273.3±35.0 °C(Predicted) |
| Density | 1.330±0.06 g/cm3(Predicted) |
| refractive index | 1.469 |
| Flash point: | 115.5±20.8 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.95±0.46(Predicted) |
| color | Pale Yellow to Light Yellow |
| InChI | InChI=1S/C11H9F3O3/c1-17-11(16)4-7(15)2-6-3-9(13)10(14)5-8(6)12/h3,5H,2,4H2,1H3 |
| InChIKey | XDQLWVSUKUDAEO-UHFFFAOYSA-N |
| SMILES | C(C1C=C(F)C(F)=CC=1F)C(=O)CC(=O)OC |
Description and Uses
Methyl 3-Oxo-4-(2,4,5-trifluorophenyl)butanoate is a useful synthetic intermediate in the synthesis of Sitagliptin (S491000); a trizolopyrazine dipeptidyl peptidase (DPP) IV inhibitor for the treatment of type II diabetes.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311-H315-H319 |
| Precautionary statements | P501-P270-P264-P280-P337+P313-P305+P351+P338-P361+P364-P332+P313-P301+P310+P330-P302+P352+P312-P405 |
| HS Code | 2918300090 |
