A7792512
3-(Trifluoromethoxy)phenylacetic acid , 98% , 203302-97-0
CAS NO.：203302-97-0
Empirical Formula: C9H7F3O3
Molecular Weight: 220.15
MDL number: MFCD00082480
EINECS: 642-512-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB119.20 | In Stock |
|
| 10g | RMB239.20 | In Stock |
|
| 25g | RMB433.60 | In Stock |
|
| 100g | RMB2039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-55°C |
| Boiling point: | 260.2±35.0 °C(Predicted) |
| Density | 1.399±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.10±0.10(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C9H7F3O3/c10-9(11,12)15-7-3-1-2-6(4-7)5-8(13)14/h1-4H,5H2,(H,13,14) |
| InChIKey | NFZQVADYFXRRPM-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC(OC(F)(F)F)=C1 |
| CAS DataBase Reference | 203302-97-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-36-37 |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
