PRODUCT Properties
| Melting point: | 104-108°C |
| Boiling point: | 489.25°C (rough estimate) |
| Density | 1.2233 (rough estimate) |
| refractive index | 1.6800 (estimate) |
| storage temp. | 2-8°C |
| solubility | Very soluble in water, freely soluble in ethanol (96 per cent), in methanol and in methylene chloride. |
| form | Solid |
| color | White |
| Water Solubility | >=1 g/100 mL at 24 ºC |
| λmax | 262nm(lit.) |
| Merck | 14,7235 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C16H20N2.C4H4O4/c1-18(2)13-11-15(14-8-4-3-5-9-14)16-10-6-7-12-17-16;5-3(6)1-2-4(7)8/h3-10,12,15H,11,13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | SSOXZAQUVINQSA-BTJKTKAUSA-N |
| SMILES | C(CCN(C)C)(C1C=CC=CN=1)C1C=CC=CC=1.C(/C(=O)O)=C/C(=O)O |
| CAS DataBase Reference | 132-20-7(CAS DataBase Reference) |
| EPA Substance Registry System | Pheniramine maleate (132-20-7) |
Description and Uses
Pheniramine, a H1-receptor antagonist, is an antihistamine with anticholinergic and sedative properties. Pheniramine is used to treat allergic conditions such as hay fever or urticaria.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | UT0175000 |
| TSCA | TSCA listed |
| HS Code | 2933399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
