4-Thiouridine , 98% , 13957-31-8
Synonym(s):
RNA synthesis inhibitor
CAS NO.:13957-31-8
Empirical Formula: C9H12N2O5S
Molecular Weight: 260.27
MDL number: MFCD00006538
EINECS: 237-735-3
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB207.20 | In Stock |
|
| 25MG | RMB439.20 | In Stock |
|
| 100MG | RMB849.60 | In Stock |
|
| 500mg | RMB2399.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 139-140℃ (ethanol ) |
| Density | 1.72±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | crystalline |
| pka | 4.75±0.20(Predicted) |
| color | light yellow |
| PH | 8.2 |
| biological source | synthetic (organic) |
| Water Solubility | Soluble in water (20 mg/ml), and methanol (10 mg/ml). |
| λmax | 245,331 (pH 6.5);316 (pH 12) |
| InChI | InChI=1S/C9H12N2O5S/c12-3-4-6(13)7(14)8(16-4)11-2-1-5(17)10-9(11)15/h1-2,4,6-8,12-14H,3H2,(H,10,15,17)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | ZLOIGESWDJYCTF-XVFCMESISA-N |
| SMILES | OC[C@H]1O[C@@H](N2C=CC(=S)NC2=O)[C@H](O)[C@@H]1O |
| CAS DataBase Reference | 13957-31-8(CAS DataBase Reference) |
Description and Uses
4-Thiouridine (4-SU) is a photoactivatable ribonucleoside analog that is widely used for RNA analysis, including short-range RNA-RNA crosslinking and nascent RNA labeling. The crosslinking thio moiety is attached directly to the nucleotide base, thus 4-SU differs from uridine only by a single sulfur substitution. This offers the advantage of incorporating into an RNA chain with minimal structural perturbation and with similar base-pairing properties, reducing the likelihood that substitution will impair RNA interactions or activities.
Nucleotide analogue, essential for cell growth in certain bacterial species. This compound is also able to chelate with certain metal ions, and in tRNA it can act as a built-in antiphotomutagenic agent that protects Escherichia coli cells against mutagenesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |






