A7793912
5,10,15,20-Tetrakis(4-aminophenyl)porphyrin , 95% , 22112-84-1
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB158.40 | In Stock |
|
| 250mg | RMB318.40 | In Stock |
|
| 500mg | RMB519.20 | In Stock |
|
| 1g | RMB943.20 | In Stock |
|
| 5g | RMB3919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.350 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystal |
| color | Dark red to Dark purple to Dark blue |
| InChIKey | REPFNYFEIOZRLM-LWQDQPMZSA-N |
| SMILES | C1(C2=CC=C(N)C=C2)=C2N=C(C(C3=CC=C(N)C=C3)=C3NC(=C(C4=CC=C(N)C=C4)C4=NC(=C(C5=CC=C(N)C=C5)C5NC1=CC=5)C=C4)C=C3)C=C2 |c:20,t:8,23,35| |
Description and Uses
5,10,15,20-Tetrakis(4-aminophenyl)porphyrin (CAS# 22112-84-1) is a porphyrin derivative used in the preparation of metal complexes, such as those of Fe(III) for the use of catalyzing the electrochemical oxygen reduction reaction.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| HS Code | 29339900 |
