A7794312
4-(Trifluoromethylthio)benzoyl chloride , 98% , 330-14-3
CAS NO.:330-14-3
Empirical Formula: C8H4ClF3OS
Molecular Weight: 240.63
MDL number: MFCD01631632
EINECS: 624-289-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB143.20 | In Stock |
|
| 5G | RMB462.40 | In Stock |
|
| 25G | RMB1684.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 229-230 °C (lit.) |
| Density | 1.445 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 117 °F |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | soluble in Chloroform, Ethyl Acetate |
| form | clear liquid |
| Specific Gravity | 1.430 |
| color | Colorless to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2723544 |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C8H4ClF3OS/c9-7(13)5-1-3-6(4-2-5)14-8(10,11)12/h1-4H |
| InChIKey | BCMFTOCCLOAGBP-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=C(SC(F)(F)F)C=C1 |
| CAS DataBase Reference | 330-14-3(CAS DataBase Reference) |
Description and Uses
4-(Trifluoromethylthio)benzoyl Chloride is a reactant in the preparation of anthranilic acids as selective and dual PPAR/FXR ligands.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 10-34 |
| Safety Statements | 16-26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29309090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





