A7795012
N-tert-Butoxycarbonylimidazole , 98% , 49761-82-2
CAS NO.:49761-82-2
Empirical Formula: C8H12N2O2
Molecular Weight: 168.19
MDL number: MFCD00014497
EINECS: 256-475-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB33.60 | In Stock |
|
| 25G | RMB108.00 | In Stock |
|
| 100G | RMB344.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-47 °C(lit.) |
| Boiling point: | 147-150 °C(lit.) |
| Density | 1.1835 (rough estimate) |
| refractive index | 1.4200 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Soluble in hexane, acetone, and DMF. |
| pka | 3.49±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Moisture Sensitive |
| BRN | 607792 |
| InChI | InChI=1S/C8H12N2O2/c1-8(2,3)12-7(11)10-5-4-9-6-10/h4-6H,1-3H3 |
| InChIKey | MTBKGWHHOBJMHJ-UHFFFAOYSA-N |
| SMILES | C1N(C(OC(C)(C)C)=O)C=CN=1 |
| CAS DataBase Reference | 49761-82-2(CAS DataBase Reference) |
Description and Uses
1-Boc-imidazole is used in the preparation of water soluble polyrotaxane, via modification of α-cyclodextrin in the presence of KOH and N,N-carbonyldiimidazole.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933299090 |






![tert-Butyl2-hydroxy-1H-benzo[d]imidazole-1-carboxylate](https://img.chemicalbook.com/CAS/GIF/161468-45-7.gif)