A7795112
3-(Trifluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid , 97% , 113100-53-1
CAS NO.:113100-53-1
Empirical Formula: C6H5F3N2O2
Molecular Weight: 194.11
MDL number: MFCD01936005
EINECS: 601-232-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB84.80 | In Stock |
|
| 25g | RMB357.60 | In Stock |
|
| 100g | RMB1392.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203 °C |
| Boiling point: | 285.6±40.0 °C(Predicted) |
| Density | 1.56±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 2.93±0.36(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C6H5F3N2O2/c1-11-2-3(5(12)13)4(10-11)6(7,8)9/h2H,1H3,(H,12,13) |
| InChIKey | FZNKJQNEJGXCJH-UHFFFAOYSA-N |
| SMILES | N1(C)C=C(C(O)=O)C(C(F)(F)F)=N1 |
Description and Uses
3-(Trifluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic Acid is used in the synthesis of diaryl ether inhibitors of Toxoplasma gondii enoyl reductase. Also used in the synthesis of 4-carboxamide derivatives acting as antifungal agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-24/25 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| HS Code | 29331990 |
| Storage Class | 11 - Combustible Solids |






