A7795612
Tropicamide , ≥99.0% , 1508-75-4
Synonym(s):
N-Ethyl-2-phenyl-N-(4-pyridylmethyl)hydracrylamide;Ro 1-7683;Tropicamide
CAS NO.:1508-75-4
Empirical Formula: C17H20N2O2
Molecular Weight: 284.35
MDL number: MFCD00058580
EINECS: 216-140-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB121.60 | In Stock |
|
| 5G | RMB303.20 | In Stock |
|
| 10g | RMB949.60 | In Stock |
|
| 25g | RMB1056.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98 °C |
| Boiling point: | 492.8±45.0 °C(Predicted) |
| Density | 1.161±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | 45% (w/v) aq 2-hydroxypropyl-β-cyclodextrin: 4.3 mg/mL |
| form | solid |
| pka | pKa 5.3 (Uncertain) |
| color | white |
| Water Solubility | 0.2g/L(25 ºC) |
| λmax | 254nm(HCl aq.)(lit.) |
| Merck | 14,9780 |
| InChI | InChI=1S/C17H20N2O2/c1-2-19(12-14-8-10-18-11-9-14)17(21)16(13-20)15-6-4-3-5-7-15/h3-11,16,20H,2,12-13H2,1H3 |
| InChIKey | BGDKAVGWHJFAGW-UHFFFAOYSA-N |
| SMILES | C(CO)(C(=O)N(CC)CC1=CC=NC=C1)C1C=CC=CC=1 |
| CAS DataBase Reference | 1508-75-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Tropicamide(1508-75-4) |
Description and Uses
Tropicamide, like cyclopentolate, is used in ophthalmoscopy for reaching pre-operational mydraises and for testing narrow-angle glaucoma.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H317-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-42/43-41-37/38-22 |
| Safety Statements | 22-26-36-36/37/39 |
| WGK Germany | 3 |
| RTECS | CY1487860 |
| HS Code | 29333990 |





![1,1’-Ethylidenebis[L-tryptophan]](https://img.chemicalbook.com/CAS/GIF/132685-02-0.gif)

