A7796612
Triallyl Isocyanurate , 98%, including 500ppMBHT stabilizer , 1025-15-6
Synonym(s):
Triallyl isocyanurate;1,3,5-Triallyl-1,3,5-triazine-2,4,6(1H,3H,5H)-trione;1,3,5-Triallylisocyanurate;1,3,5-Triallylisocyanuric acid;1,3,5-Tris-2′-propenylisocyanuric acid
CAS NO.:1025-15-6
Empirical Formula: C12H15N3O3
Molecular Weight: 249.27
MDL number: MFCD00006554
EINECS: 213-834-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB39.20 | In Stock |
|
| 500G | RMB142.40 | In Stock |
|
| 2.5KG | RMB703.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 20.5°C |
| Boiling point: | 149-152 °C4 mm Hg(lit.) |
| Density | 1.159 g/mL at 25 °C(lit.) |
| vapor pressure | 3.5 hPa (143 °C) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | 3.7g/l |
| form | Liquid After Melting |
| pka | -2.33±0.20(Predicted) |
| color | Clear colorless to yellow |
| Water Solubility | > 1 g/L (20 ºC) |
| BRN | 225482 |
| Stability: | May be prone to spontaneous polymerization. Commercial product is generally supllied with added stabilizer such as t-butylhydroquinone. Incompatible with peroxides, strong oxidizing agents, strong acids, strong bases. |
| InChI | 1S/C12H15N3O3/c1-4-7-13-10(16)14(8-5-2)12(18)15(9-6-3)11(13)17/h4-6H,1-3,7-9H2 |
| InChIKey | KOMNUTZXSVSERR-UHFFFAOYSA-N |
| SMILES | C=CCN1C(=O)N(CC=C)C(=O)N(CC=C)C1=O |
| LogP | 1.92 at 25℃ |
| CAS DataBase Reference | 1025-15-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tri-2-propenyl-(1025-15-6) |
| EPA Substance Registry System | Triallyl isocyanurate (1025-15-6) |
Description and Uses
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H373 |
| Precautionary statements | P260-P264-P270-P301+P312-P314-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36/37/39 |
| WGK Germany | 1 |
| RTECS | XZ1915000 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 2929109000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral STOT RE 2 |
| Toxicity | LD50 orally in Rabbit: 700 mg/kg LD50 dermal Rat 2480 mg/kg |






