A7797512
2,3,4-Trifluoroaniline , ≥98.0% , 3862-73-5
CAS NO.:3862-73-5
Empirical Formula: C6H4F3N
Molecular Weight: 147.1
MDL number: MFCD00011737
EINECS: 253-703-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB57.60 | In Stock |
|
| 100G | RMB164.80 | In Stock |
|
| 500g | RMB659.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 14-15°C |
| Boiling point: | 92 °C/48 mmHg (lit.) |
| Density | 1.393 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 155 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 2.25±0.10(Predicted) |
| form | A liquid |
| Specific Gravity | 1.393 |
| color | Colorless to Light yellow to Light orange |
| BRN | 3245609 |
| InChI | InChI=1S/C6H4F3N/c7-3-1-2-4(10)6(9)5(3)8/h1-2H,10H2 |
| InChIKey | WRDGNXCXTDDYBZ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(F)C(F)=C1F |
| CAS DataBase Reference | 3862-73-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, 2,3,4-trifluoro-C198 (3862-73-5) |
Description and Uses
2,3,4-Trifluoroaniline was used in preparation of diethyl 2-(2,3,4-trifluoro)-phenylaminomethylene malonate.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302+H312-H315-H318-H373-H411 |
| Precautionary statements | P273-P280-P301+P312-P302+P352+P312-P305+P351+P338-P314 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 21/22-38-41-48/22-51/53 |
| Safety Statements | 23-26-36/37/39-61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 3 |
| RTECS | CY1211500 |
| F | 9 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29214210 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Irrit. 2 STOT RE 2 |
| Toxicity | LD50 orl-rat: 699 mg/kg JACTDZ 1,61,90 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |










