A6891512
Pentafluorophenylhydrazine , >98.0%(GC) , 828-73-9
Synonym(s):
(Perfluorophenyl)hydrazine;NSC 88334;PFPH
CAS NO.:828-73-9
Empirical Formula: C6H3F5N2
Molecular Weight: 198.09
MDL number: MFCD00007574
EINECS: 212-586-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB76.80 | In Stock |
|
| 5G | RMB208.80 | In Stock |
|
| 25G | RMB755.20 | In Stock |
|
| 100g | RMB2879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-76 °C(lit.) |
| Boiling point: | 117.6±40.0 °C(Predicted) |
| Density | 1.4980 (estimate) |
| storage temp. | -20°C |
| solubility | Soluble in methanol. |
| form | powder to crystal |
| pka | 4.05±0.40(Predicted) |
| color | White to Brown |
| Sensitive | Air Sensitive |
| BRN | 747800 |
| InChI | InChI=1S/C6H3F5N2/c7-1-2(8)4(10)6(13-12)5(11)3(1)9/h13H,12H2 |
| InChIKey | BYCUWCJUPSUFBX-UHFFFAOYSA-N |
| SMILES | N(C1=C(F)C(F)=C(F)C(F)=C1F)N |
| CAS DataBase Reference | 828-73-9(CAS DataBase Reference) |
Description and Uses
Pentafluorophenylhydrazine used to determine the purity of N-tert-butyl-N-[1-diethylphosphono-(2,2-dimethylpropyl)]nitroxide (DEPN) using 1H NMR spectroscopy.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | MV8325000 |
| HazardClass | IRRITANT |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







