A7797912
3′-(Trifluoromethoxy)acetophenone , ≥97.0% , 170141-63-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB42.40 | In Stock |
|
| 5G | RMB132.00 | In Stock |
|
| 25G | RMB466.40 | In Stock |
|
| 100g | RMB1335.20 | In Stock |
|
| 500g | RMB5119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 49-51 °C (13 mmHg) |
| Density | 1.285 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 182 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.285 |
| BRN | 6196333 |
| InChI | 1S/C9H7F3O2/c1-6(13)7-3-2-4-8(5-7)14-9(10,11)12/h2-5H,1H3 |
| InChIKey | UYHTUQHYGKAYJM-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cccc(OC(F)(F)F)c1 |
| CAS DataBase Reference | 170141-63-6(CAS DataBase Reference) |
Description and Uses
3μ-(Trifluoromethoxy)acetophenone (m-(trifluoromethoxy)acetophenone) may be used in the preparation of 4-(3μ-trifluoromethoxyphenyl)-thiazol-2-yl ammonium iodide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P210e-P280a-P370+P378a-P501a-P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-26 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
