A7798412
4-(Trifluoromethylthio)benzoic acid , >97.0%(GC) , 330-17-6
CAS NO.:330-17-6
Empirical Formula: C8H5F3O2S
Molecular Weight: 222.18
MDL number: MFCD00040906
EINECS: 625-833-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB89.60 | In Stock |
|
| 5G | RMB172.80 | In Stock |
|
| 25G | RMB663.20 | In Stock |
|
| 100g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159.5-162.5 °C(lit.) |
| Boiling point: | 227.6±40.0 °C(Predicted) |
| Density | 1.50±0.1 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.76±0.10(Predicted) |
| color | White to Almost white |
| Sensitive | Stench |
| BRN | 2693449 |
| InChI | 1S/C8H5F3O2S/c9-8(10,11)14-6-3-1-5(2-4-6)7(12)13/h1-4H,(H,12,13) |
| InChIKey | UMOGQQWVQUQTQA-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(SC(F)(F)F)cc1 |
| CAS DataBase Reference | 330-17-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Stench |
| HazardClass | IRRITANT |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







