PRODUCT Properties
| Melting point: | 130-131 °C (lit.) |
| Boiling point: | 233.5±35.0 °C(Predicted) |
| Density | 1.536±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.00±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2579153 |
| InChI | InChI=1S/C7H3F3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,(H,11,12) |
| InChIKey | MGUPHQGQNHDGNK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(F)C=CC(F)=C1F |
| CAS DataBase Reference | 2358-29-4(CAS DataBase Reference) |
Description and Uses
2,3,6-Trifluorobenzoic acid is a trifluorinated analogue of Benzoic acid (B203900). 2,3,6-Trifluorobenzoic acid is a very useful synthetic intermediate that is commonly used to prepare inhibitors of malaria aspartyl proteases Plasmepsin I and II.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29163990 |
