A7799512
3-Thiophenemalonic acid , 98% , 21080-92-2
Synonym(s):
α-Carboxythiophene-3-acetic acid;(3-Thienyl)malonic acid
CAS NO.:21080-92-2
Empirical Formula: C7H6O4S
Molecular Weight: 186.19
MDL number: MFCD00005469
EINECS: 244-198-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB48.00 | In Stock |
|
| 25G | RMB164.80 | In Stock |
|
| 100G | RMB544.00 | In Stock |
|
| 500g | RMB1904.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139 °C (dec.) (lit.) |
| Boiling point: | 290.67°C (rough estimate) |
| Density | 1.5439 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | 2-8°C |
| pka | 2.73±0.10(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 6503620 |
| InChI | InChI=1S/C7H6O4S/c8-6(9)5(7(10)11)4-1-2-12-3-4/h1-3,5H,(H,8,9)(H,10,11) |
| InChIKey | GCOOGCQWQFRJEK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(C1C=CSC=1)C(O)=O |
| CAS DataBase Reference | 21080-92-2(CAS DataBase Reference) |
| EPA Substance Registry System | Propanedioic acid, 3-thienyl- (21080-92-2) |
Description and Uses
3-Thiophenemalonic Acid (Ticarcillin EP Impurity C) is an intermediate used to synthesize temocillin. It is also used to prepare malonate-based inhibitors of mammalian serine racemase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







