A7991612
Thiophene-3-acetic Acid , >98.0%(T) , 6964-21-2
Synonym(s):
3-Thienylacetic acid
CAS NO.:6964-21-2
Empirical Formula: C6H6O2S
Molecular Weight: 142.18
MDL number: MFCD00005473
EINECS: 230-166-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB119.20 | In Stock |
|
| 25G | RMB405.60 | In Stock |
|
| 100G | RMB1516.80 | In Stock |
|
| 250g | RMB3359.20 | In Stock |
|
| 500g | RMB5919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-76 °C(lit.) |
| Boiling point: | 129°C 2,5mm |
| Density | 1.365 (estimate) |
| refractive index | 1.5300 (estimate) |
| Flash point: | 129°C/2.5mm |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 4.25±0.10(Predicted) |
| form | Crystalline Flakes or Powder |
| color | Off-white to beige |
| Water Solubility | Very soluble in water. |
| BRN | 113622 |
| InChI | InChI=1S/C6H6O2S/c7-6(8)3-5-1-2-9-4-5/h1-2,4H,3H2,(H,7,8) |
| InChIKey | RCNOGGGBSSVMAS-UHFFFAOYSA-N |
| SMILES | C1SC=CC=1CC(O)=O |
| CAS DataBase Reference | 6964-21-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Thiopheneacetic acid(6964-21-2) |
Description and Uses
3-Thiopheneacetic acid was used in:
- one-step, size control synthesis of gold nanoparticles
- in the preparation of gold nanoparticles capped with 3-thiopheneacetic acid (3-TAA) via borohydride reduction
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 26-24/25-45-36/37/39-27 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| RTECS | XM7570000 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29349990 |





