A7802112
3,3′,5-Triiodothyroacetic acid , 90% , 51-24-1
Synonym(s):
4-(4-Hydroxy-3-iodophenoxy)-3,5-diiodophenylacetic acid
CAS NO.:51-24-1
Empirical Formula: C14H9I3O4
Molecular Weight: 621.93
MDL number: MFCD00055931
EINECS: 200-086-1
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB316.80 | In Stock |
|
| 500MG | RMB952.00 | In Stock |
|
| 1g | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65°; mp 180-183° |
| Boiling point: | 531.6±50.0 °C(Predicted) |
| Density | 2.466±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated, Sonicated) |
| form | Solid |
| pka | 4.02±0.10(Predicted) |
| color | White to Pale Beige |
| InChI | InChI=1S/C14H9I3O4/c15-9-6-8(1-2-12(9)18)21-14-10(16)3-7(4-11(14)17)5-13(19)20/h1-4,6,18H,5H2,(H,19,20) |
| InChIKey | UOWZUVNAGUAEQC-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC(I)=C(OC2=CC=C(O)C(I)=C2)C(I)=C1 |
Description and Uses
3,3'',5-Triiodo Thyroacetic Acid (T3-Acetic Acid (USP)) is a thyroid hormone analogue. A potent Thyroxine impurity. Levothyroxine EP Impurity C.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| HS Code | 2916.39.7900 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |






