A7802912
trans-1,2-Cyclohexanedicarboxylic Acid , ≥98.0% , 2305-32-0
Synonym(s):
trans-Cyclohexane-1,2-dicarboxylic acid;trans-Hexahydrophthalic acid;trans-Cyclohexane-1,2-dicarboxylic acid;trans-Hexahydrophthalic acid
CAS NO.:2305-32-0
Empirical Formula: C8H12O4
Molecular Weight: 172.18
MDL number: MFCD00001464
EINECS: 218-975-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB49.60 | In Stock |
|
| 100G | RMB182.40 | In Stock |
|
| 500g | RMB831.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 228-230 °C (lit.) |
| Boiling point: | 262.49°C (rough estimate) |
| Density | 1.2104 (rough estimate) |
| refractive index | 1.4450 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | Acetone (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | pK1:4.18;pK2: 5.93 (20°C) |
| color | White |
| Water Solubility | 2g/L(20 ºC) |
| BRN | 3200609 |
| InChI | 1S/C8H12O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12)/t5-,6-/m0/s1 |
| InChIKey | QSAWQNUELGIYBC-WDSKDSINSA-N |
| SMILES | OC(=O)[C@@H]1CCCC[C@H]1C(O)=O |
| CAS DataBase Reference | 2305-32-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Cyclohexanedicarboxylic acid, trans-(2305-32-0) |
| EPA Substance Registry System | 1,2-Cyclohexanedicarboxylic acid, (1R,2R)-rel- (2305-32-0) |
Description and Uses
trans-1,2-cyclohexanedicarboxylic acid be used as organic intermediates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | GU9065000 |
| TSCA | TSCA listed |
| HS Code | 29172000 |
| Storage Class | 13 - Non Combustible Solids |






