A7803612
Tetraheptylammonium bromide , 99% , 4368-51-8
Synonym(s):
THPAB
CAS NO.:4368-51-8
Empirical Formula: C28H60BrN
Molecular Weight: 490.69
MDL number: MFCD00011861
EINECS: 224-459-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB56.80 | In Stock |
|
| 5G | RMB140.80 | In Stock |
|
| 25G | RMB510.40 | In Stock |
|
| 100G | RMB1912.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-89 °C(lit.) |
| Density | 1.0311 (rough estimate) |
| refractive index | 1.5260 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Flakes |
| color | White |
| Odor | Odorless |
| Water Solubility | Soluble in water and methanol. |
| Sensitive | Hygroscopic |
| λmax | λ: 240 nm Amax: 0.04 λ: 250 nm Amax: 0.03 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02 |
| BRN | 3763391 |
| Stability: | Hygroscopic |
| InChI | 1S/C28H60N.BrH/c1-5-9-13-17-21-25-29(26-22-18-14-10-6-2,27-23-19-15-11-7-3)28-24-20-16-12-8-4;/h5-28H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | YQIVQBMEBZGFBY-UHFFFAOYSA-M |
| SMILES | [Br-].CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC |
| CAS DataBase Reference | 4368-51-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetraheptylammonium bromide(4368-51-8) |
| EPA Substance Registry System | Tetraheptylammonium bromide (4368-51-8) |
Description and Uses
Tetraheptylammonium Bromide is a catalyst in organic polymer synthesis involving redox-active crystals of polymetalate. Reagent used in the preparation of ionic liquids as novel quartz collectors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




