A7819912
Tyrphostin 23 , ≥98% , 118409-57-7
Synonym(s):
α-Cyano-(3,4-dihydroxy)cinnamonitrile, Tyrphostin A23, RG-50810;(3,4-Dihydroxybenzylidene)malononitrile;AG 18 - CAS 118409-57-7 - Calbiochem;RG-50810
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB337.60 | In Stock |
|
| 50MG | RMB1132.00 | In Stock |
|
| 250MG | RMB4400.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225°C |
| Boiling point: | 421.1±45.0 °C(Predicted) |
| Density | 1.428±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO, ethanol, or DMF |
| pka | 7.26±0.18(Predicted) |
| form | Yellow solid |
| color | Yellow |
| biological source | synthetic (organic) |
| λmax | 464nm(DMSO)(lit.) |
| Stability: | Store in refrigerator |
| InChI | 1S/C10H6N2O2/c11-5-8(6-12)3-7-1-2-9(13)10(14)4-7/h1-4,13-14H |
| InChIKey | VTJXFTPMFYAJJU-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1O)\C=C(\C#N)C#N |
Description and Uses
A specific inhibitor for the epidermal growth factor receptor. Also inhibits EGF-dependent cell proliferation (IC50=35uM).
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H371-H373 |
| Precautionary statements | P501-P260-P270-P264-P308+P311-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2926.90.5050 |
| Storage Class | 11 - Combustible Solids |






