A0914850
AG99 , ≥99%(HPLC) , 122520-85-8
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB311.20 | In Stock |
|
| 50mg | RMB1079.20 | In Stock |
|
| 100mg | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 247 °C |
| Boiling point: | 544.4±50.0 °C(Predicted) |
| Density | 1.482±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in DMSO |
| pka | 8.81±0.10(Predicted) |
| form | Brown solid. |
| color | Light yellow to yellow |
| InChI | InChI=1S/C10H8N2O3/c11-5-7(10(12)15)3-6-1-2-8(13)9(14)4-6/h1-4,13-14H,(H2,12,15)/b7-3+ |
| InChIKey | USOXQZNJFMKTKJ-XVNBXDOJSA-N |
| SMILES | C(N)(=O)/C(/C#N)=C/C1=CC=C(O)C(O)=C1 |
Description and Uses
Tyrphostin AG 99 is a potent, cell-permeable and reversible inhibitor of EGFR and EGF-dependent cell proliferation.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
