A7823312
Trichlormethiazide , ≥98% , 133-67-5
Synonym(s):
6-Chloro-3-(dichloromethyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide
(+/-)-;NSC 61560
CAS NO.:133-67-5
Empirical Formula: C8H8Cl3N3O4S2
Molecular Weight: 380.66
MDL number: MFCD00057315
EINECS: 205-118-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB362.40 | In Stock |
|
| 10g | RMB501.60 | In Stock |
|
| 25G | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 248-250℃ |
| Boiling point: | 631.3±65.0 °C(Predicted) |
| Density | 1.748 |
| refractive index | 1.6000 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | pKa 6.9(acetone/H2O) (Uncertain) |
| color | White to Off-White |
| Merck | 14,9624 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C8H8Cl3N3O4S2/c9-3-1-4-6(2-5(3)19(12,15)16)20(17,18)14-8(13-4)7(10)11/h1-2,7-8,13-14H,(H2,12,15,16) |
| InChIKey | LMJSLTNSBFUCMU-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cc2c(NC(NS2(=O)=O)C(Cl)Cl)cc1Cl |
| CAS DataBase Reference | 133-67-5(CAS DataBase Reference) |
| EPA Substance Registry System | Trichlormethiazide (133-67-5) |
Description and Uses
diuretic, antihypertensive
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H334 |
| Precautionary statements | P261-P272-P280-P284-P302+P352-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | 42/43 |
| Safety Statements | 36 |
| RIDADR | UN2811 |
| WGK Germany | 2 |
| RTECS | DK8925000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| HS Code | 2935904000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Resp. Sens. 1 Skin Sens. 1 |
| Hazardous Substances Data | 133-67-5(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: >20000 mg/kg (Goldenthal) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





