A7825512
2-(Trifluoromethoxy)benzenesulfonyl chloride , 97% , 103008-51-1
CAS NO.:103008-51-1
Empirical Formula: C7H4ClF3O3S
Molecular Weight: 260.62
MDL number: MFCD00052316
EINECS: 624-794-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB47.20 | In Stock |
|
| 25g | RMB169.60 | In Stock |
|
| 100g | RMB497.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27-31 °C (lit.) |
| Boiling point: | 75-77 °C/1 mmHg (lit.) |
| Density | 1.565±0.06 g/cm3(Predicted) |
| refractive index | 1.4825 |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | low melting solid |
| color | Clear, almost colourless |
| Sensitive | Moisture Sensitive |
| BRN | 8482182 |
| InChI | 1S/C7H4ClF3O3S/c8-15(12,13)6-4-2-1-3-5(6)14-7(9,10)11/h1-4H |
| InChIKey | JLTBWYIUMFEOTN-UHFFFAOYSA-N |
| SMILES | FC(F)(F)Oc1ccccc1S(Cl)(=O)=O |
| CAS DataBase Reference | 103008-51-1(CAS DataBase Reference) |
Description and Uses
2-(Trifluoromethoxy)benzenesulfonyl chloride is a useful research chemical.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P405-P501a-P280-P305+P351+P338-P310 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-39-37-36 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29189900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







